Systematic / IUPAC Name: (8-Bromo-1-naphthyl)(1-pentyl-1H-indol-3-yl)methanone
ID: Reference5403
Other Names:
Methanone, (8-bromo-1-naphthalenyl)(1-pentyl-1H-indol-3-yl)-;
JWH 424
Formula: C24H22BrNO
Class: Drugs of Abuse/Illegal Drugs
JWH-424 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/3/2016 12:53:42 PM |
| InChI | InChI=1S/C24H22BrNO/c1-2-3-6-15-26-16-20(18-11-4-5-14-22(18)26)24(27)19-12-7-9-17-10-8-13-21(25)23(17)19/h4-5,7-14,16H,2-3,6,15H2,1H3 |
| InChI Key | QXZYVJRMQVOOEQ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCN1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=C3C(=CC=C4)Br |
| CAS | 1366068043 |
| Splash | |
| Other Names |
Methanone, (8-bromo-1-naphthalenyl)(1-pentyl-1H-indol-3-yl)-; JWH 424 |
| ChemSpider | 28645324 |
| ChEMBL | CHEMBL2206846 |
| PubChem | 57458937 |
| Wikipedia | JWH-424 |