Systematic / IUPAC Name: [1-(Cyclohexylmethyl)-1H-indol-3-yl](4-methoxy-1-naphthyl)methanone
ID: Reference5447
Other Names: Methanone, [1-(cyclohexylmethyl)-1H-indol-3-yl](4-methoxy-1-naphthalenyl)-
Formula: C27H27NO2
Class: Drugs of Abuse/Illegal Drugs
JWH 081-N-(cyclohexylmethyl) analog mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/5/2016 12:16:52 PM |
| InChI | InChI=1S/C27H27NO2/c1-30-26-16-15-23(20-11-5-6-13-22(20)26)27(29)24-18-28(17-19-9-3-2-4-10-19)25-14-8-7-12-21(24)25/h5-8,11-16,18-19H,2-4,9-10,17H2,1H3 |
| InChI Key | LMENRXZOUBANKQ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C2=CC=CC=C21)C(=O)C3=CN(C4=CC=CC=C43)CC5CCCCC5 |
| CAS | 1373876346 |
| Splash | |
| Other Names | Methanone, [1-(cyclohexylmethyl)-1H-indol-3-yl](4-methoxy-1-naphthalenyl)- |