Systematic / IUPAC Name: 2-(2-Methoxyphenyl)-1-{1-[(1-methyl-2-piperidinyl)methyl]-1H-indol-3-yl}ethanone
ID: Reference5525
Other Names: Ethanone, 2-(2-methoxyphenyl)-1-{1-[(1-methyl-2-piperidinyl)methyl]-1H-indol-3-yl}-
Formula: C24H28N2O2
Class: Drugs of Abuse/Illegal Drugs
Cannabipiperidiethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/17/2016 8:45:30 AM |
| InChI | InChI=1S/C24H28N2O2/c1-25-14-8-7-10-19(25)16-26-17-21(20-11-4-5-12-22(20)26)23(27)15-18-9-3-6-13-24(18)28-2/h3-6,9,11-13,17,19H,7-8,10,14-16H2,1-2H3 |
| InChI Key | AJSBNWAHEDVQJT-UHFFFAOYSA-N |
| Canonical SMILES | CN1CCCCC1CN2C=C(C3=CC=CC=C32)C(=O)CC4=CC=CC=C4OC |
| CAS | 1345970435 |
| Splash | |
| Other Names | Ethanone, 2-(2-methoxyphenyl)-1-{1-[(1-methyl-2-piperidinyl)methyl]-1H-indol-3-yl}- |
| ChemSpider | 27330303 |
| PubChem | 53494930 |
| Wikipedia | Cannabipiperidiethanone |