Systematic / IUPAC Name: 1-Naphthyl(1-propyl-1H-indol-3-yl)methanone
ID: Reference5526
Other Names:
1-Naphthalenyl(1-propyl-1H-indol-3-yl)methanone ;
Naphthalen-1-yl(1-propyl-1H-indol-3-yl)methanone
Formula: C22H19NO
Class: Drugs of Abuse/Illegal Drugs
JWH 072 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 122 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/17/2016 8:49:02 AM |
| InChI | InChI=1S/C22H19NO/c1-2-14-23-15-20(18-11-5-6-13-21(18)23)22(24)19-12-7-9-16-8-3-4-10-17(16)19/h3-13,15H,2,14H2,1H3 |
| InChI Key | IVLWWVXVWRIXSS-UHFFFAOYSA-N |
| Canonical SMILES | CCCN1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43 |
| CAS | 209414062 |
| Splash | |
| Other Names |
1-Naphthalenyl(1-propyl-1H-indol-3-yl)methanone ; Naphthalen-1-yl(1-propyl-1H-indol-3-yl)methanone |
| ChEMBL | CHEMBL563390 |
| PubChem | 45271208 |
| ChemSpider | 24629912 |