Systematic / IUPAC Name: 4-Methoxy-6-[(E)-2-(4-methoxyphenyl)vinyl]-2H-pyran-2-one
ID: Reference5539
Other Names:
(E)-4-Methoxy-6-(4-methoxystyryl)-2H-pyran-2-one;
2H-Pyran-2-one, 4-methoxy-6-(p-methoxystyryl)-;
2H-Pyran-2-one, 4-methoxy-6-[2-(4-methoxyphenyl)ethenyl], (E)-;
4-Methoxy-6-[β-(p-anisyl)vinyl]-α-pyrone ;
4-Methoxy-6-(p-methoxystyryl)-2H-pyran-2-one
; more
Formula: C15H14O4
Class: Endogenous Metabolites
Yangonin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/19/2016 12:22:58 PM |
| InChI | InChI=1S/C15H14O4/c1-17-12-6-3-11(4-7-12)5-8-13-9-14(18-2)10-15(16)19-13/h3-10H,1-2H3/b8-5+ |
| InChI Key | XLHIYUYCSMZCCC-VMPITWQZSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C=CC2=CC(=CC(=O)O2)OC |
| CAS | 500629 |
| Splash | |
| Other Names |
(E)-4-Methoxy-6-(4-methoxystyryl)-2H-pyran-2-one; 2H-Pyran-2-one, 4-methoxy-6-(p-methoxystyryl)-; 2H-Pyran-2-one, 4-methoxy-6-[2-(4-methoxyphenyl)ethenyl], (E)-; 4-Methoxy-6-[β-(p-anisyl)vinyl]-α-pyrone ; 4-Methoxy-6-(p-methoxystyryl)-2H-pyran-2-one; 4-Methoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]-2H-pyran-2-one; 4-Methoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]-2-pyranone; 4-Methoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]pyran-2-one; 4-Methoxy-6-[(E)-2-(4-methoxyphenyl)vinyl]pyran-2-one; 4-Methoxy-6-[(1E)-2-(4-methoxyphenyl)ethenyl]-2H-pyran-2-one; 4-Methoxy-6-[2-(4-methoxyphenyl)ethenyl]-2H-pyran-2-one; 5-Hydroxy-3-methoxy-7-(p-methoxyphenyl)-2,4,6-heptatrienoic acid γ-lactone |
| ChEBI | CHEBI:10089 |
| ChemSpider | 4444896 |
| ChEMBL | CHEMBL1098658 |
| Wikipedia | Yangonin |
| KEGG | C09980 |
| ChemIDPlus | 000500629 |
| PubChem | 5281575 |
| HMDb | HMDB34144 |