Systematic / IUPAC Name: 2-[(4-Chlorobenzylidene)hydrazono]-1,2-diphenylethanone
ID: Reference5553
Other Names: Benzaldehyde, 4-chloro-, 1-[2-(2-oxo-1,2-diphenylethylidene)hydrazone]
Formula: C21H15ClN2O
2-[2-(4-Chlorobenzylidene)hydrazono]-1,2-diphenylethan-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/12/2016 9:03:50 AM |
| InChI | InChI=1S/C21H15ClN2O/c22-19-13-11-16(12-14-19)15-23-24-20(17-7-3-1-4-8-17)21(25)18-9-5-2-6-10-18/h1-15H |
| InChI Key | KWQRBQAHDAEYIK-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(=NN=CC2=CC=C(C=C2)Cl)C(=O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | Benzaldehyde, 4-chloro-, 1-[2-(2-oxo-1,2-diphenylethylidene)hydrazone] |