Systematic / IUPAC Name: 5-[2-(4-Hydroxyphenyl)ethyl]-4-(1-phenylethyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione
ID: Reference5558
Other Names: 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-5-[2-(4-hydroxyphenyl)ethyl]-4-(1-phenylethyl)-
Formula: C18H19N3OS
4-{2-[5-Mercapto-4-(1-phenylethyl)-4H-1,2,4-triazol-3-yl]ethyl}phenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/12/2016 9:36:10 AM |
| InChI | InChI=1S/C18H19N3OS/c1-13(15-5-3-2-4-6-15)21-17(19-20-18(21)23)12-9-14-7-10-16(22)11-8-14/h2-8,10-11,13,22H,9,12H2,1H3,(H,20,23) |
| InChI Key | CFOKTTYFJMWEKH-UHFFFAOYSA-N |
| Canonical SMILES | CC(C1=CC=CC=C1)N2C(=NNC2=S)CCC3=CC=C(C=C3)O |
| CAS | |
| Splash | |
| Other Names | 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-5-[2-(4-hydroxyphenyl)ethyl]-4-(1-phenylethyl)- |