Systematic / IUPAC Name: (E)-2-Cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enethioamide
ID: Reference5591
Other Names:
Formula: C13H14N2O3S
2-Cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enethioamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 233 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/12/2016 1:56:56 PM |
| InChI | InChI=1S/C13H14N2O3S/c1-16-10-5-8(4-9(7-14)13(15)19)6-11(17-2)12(10)18-3/h4-6H,1-3H3,(H2,15,19)/b9-4+ |
| InChI Key | QRTVQOCXVYUFQB-RUDMXATFSA-N |
| Canonical SMILES | COC1=CC(=CC(=C1OC)OC)C=C(C#N)C(=S)N |
| CAS | |
| Splash | |
| Other Names |