Systematic / IUPAC Name: 1-Methyl-2-(methylsulfanyl)-1H-imidazole-5-carbohydrazide
ID: Reference5609
Other Names: 1H-Imidazole-5-carboxylic acid, 1-methyl-2-(methylthio)-, hydrazide
Formula: C6H10N4OS
1-Methyl-2-(methylthio)-1H-imidazole-5-carbohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/13/2016 1:58:25 PM |
| InChI | InChI=1S/C6H10N4OS/c1-10-4(5(11)9-7)3-8-6(10)12-2/h3H,7H2,1-2H3,(H,9,11) |
| InChI Key | NSNZNXCXOFJFDT-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=CN=C1SC)C(=O)NN |
| CAS | |
| Splash | |
| Other Names | 1H-Imidazole-5-carboxylic acid, 1-methyl-2-(methylthio)-, hydrazide |