Systematic / IUPAC Name: 3-Benzoyl-4H-pyrido[1,2-a]pyrimidin-4-one
ID: Reference5631
Other Names: 4H-Pyrido[1,2-a]pyrimidin-4-one, 3-benzoyl-
Formula: C15H10N2O2
3-Benzoyl-4H-pyrido[1,2-a]pyrimidin-4-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/15/2016 12:42:46 PM |
| InChI | InChI=1S/C15H10N2O2/c18-14(11-6-2-1-3-7-11)12-10-16-13-8-4-5-9-17(13)15(12)19/h1-10H |
| InChI Key | XAADHDTVMSCWEE-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)C2=CN=C3C=CC=CN3C2=O |
| CAS | |
| Splash | |
| Other Names | 4H-Pyrido[1,2-a]pyrimidin-4-one, 3-benzoyl- |