Systematic / IUPAC Name: (4-Hydroxy-1-piperidinyl)(3-{[4-(3-phenyl-1,2,4-thiadiazol-5-yl)-1-piperazinyl]methyl}phenyl)methanone
ID: Reference5648
Other Names: Methanone, (4-hydroxy-1-piperidinyl)(3-{[4-(3-phenyl-1,2,4-thiadiazol-5-yl)-1-piperazinyl]methyl}phenyl)-
Formula: C25H29N5O2S
(4-Hydroxypiperidino)(3-{[4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazino]methyl}phenyl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/20/2016 8:35:58 AM |
| InChI | InChI=1S/C25H29N5O2S/c31-22-9-11-29(12-10-22)24(32)21-8-4-5-19(17-21)18-28-13-15-30(16-14-28)25-26-23(27-33-25)20-6-2-1-3-7-20/h1-8,17,22,31H,9-16,18H2 |
| InChI Key | MXQNUEGNMIHJLT-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCC1O)C(=O)C2=CC(=CC=C2)CN3CCN(CC3)C4=NC(=NS4)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names | Methanone, (4-hydroxy-1-piperidinyl)(3-{[4-(3-phenyl-1,2,4-thiadiazol-5-yl)-1-piperazinyl]methyl}phenyl)- |