Systematic / IUPAC Name: 2-[(5-Chloro-1-isopropyl-1H-benzimidazol-2-yl)sulfanyl]-1-phenylethanone
ID: Reference5657
Other Names: Ethanone, 2-{[5-chloro-1-(1-methylethyl)-1H-benzimidazol-2-yl]thio}-1-phenyl-
Formula: C18H17ClN2OS
2-[(5-Chloro-1-isopropyl-1H-benzimidazol-2-yl)sulfanyl]-1-phenyl-1-ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 233 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/20/2016 11:45:36 AM |
| InChI | InChI=1S/C18H17ClN2OS/c1-12(2)21-16-9-8-14(19)10-15(16)20-18(21)23-11-17(22)13-6-4-3-5-7-13/h3-10,12H,11H2,1-2H3 |
| InChI Key | CARBQVGQWBIIAD-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)N1C2=C(C=C(C=C2)Cl)N=C1SCC(=O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | Ethanone, 2-{[5-chloro-1-(1-methylethyl)-1H-benzimidazol-2-yl]thio}-1-phenyl- |