Systematic / IUPAC Name: (4-Methoxy-1-naphthyl)(1-pentyl-1H-indol-3-yl)methanone
ID: Reference5690
Other Names:
JWH 081;
(4-Methoxy-1-naphthalenyl)(1-pentyl-1H-indol-3-yl)methanone;
(4-Methoxy-1-naphthyl)-(1-pentylindol-3-yl)methanone;
(4-Methoxynaphthalen-1-yl)(1-pentyl-1H-indol-3-yl)methanone;
1-Pentyl-3-(4-methoxynaphthoyl)indole
; more
Formula: C25H25NO2
Class: Drugs of Abuse/Illegal Drugs
JWH-081 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/23/2016 8:49:24 AM |
| InChI | InChI=1S/C25H25NO2/c1-3-4-9-16-26-17-22(19-11-7-8-13-23(19)26)25(27)21-14-15-24(28-2)20-12-6-5-10-18(20)21/h5-8,10-15,17H,3-4,9,16H2,1-2H3 |
| InChI Key | UBMPKJKGUQDHRM-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCN1C=C(C2=CC=CC=C21)C(=O)C3=CC=C(C4=CC=CC=C43)OC |
| CAS | 210179467 |
| Splash | |
| Other Names |
JWH 081; (4-Methoxy-1-naphthalenyl)(1-pentyl-1H-indol-3-yl)methanone; (4-Methoxy-1-naphthyl)-(1-pentylindol-3-yl)methanone; (4-Methoxynaphthalen-1-yl)(1-pentyl-1H-indol-3-yl)methanone; 1-Pentyl-3-(4-methoxynaphthoyl)indole; 3-(4-Methoxynaphthalene-1-carbonyl)-1-pentylindole; 4-Methoxynaphthalen-1-yl-(1-pentylindol-3-yl)methanone ; Methanone, (4-methoxy-1-naphthalenyl)(1-pentyl-1H-indol-3-yl)- |
| ChEMBL | CHEMBL565042 |
| Wikipedia | JWH-081 |
| PubChem | 10547208 |
| ChemSpider | 8722599 |