Systematic / IUPAC Name: 5-[(E)-2-(4-Hydroxyphenyl)vinyl]-1,3-benzenediol
ID: Reference574
Other Names:
Resvida;
(E)-5-(p-Hydroxystyryl)resorcinol;
(E)-5-(4-Hydroxystyryl)benzene-1,3-diol;
(E)-5-[2-(4-Hydroxyphenyl)ethenyl]-1,3-benzenediol;
1,3-Benzenediol, 5-[2-(4-hydroxyphenyl)ethenyl]-, (E)-
; more
Formula: C14H12O3
Class: Endogenous Metabolites
Resveratrol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 566 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/31/2016 9:20:24 AM |
| InChI | InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1+ |
| InChI Key | LUKBXSAWLPMMSZ-OWOJBTEDSA-N |
| Canonical SMILES | C1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)O)O)O |
| CAS | 501360 |
| Splash | |
| Other Names |
Resvida; (E)-5-(p-Hydroxystyryl)resorcinol; (E)-5-(4-Hydroxystyryl)benzene-1,3-diol; (E)-5-[2-(4-Hydroxyphenyl)ethenyl]-1,3-benzenediol; 1,3-Benzenediol, 5-[2-(4-hydroxyphenyl)ethenyl]-, (E)- ; 5-[(E)-2-(4-Hydroxyphenyl)vinyl]benzene-1,3-diol; 5-[2-(4-Hydroxyphenyl)ethenyl]benzene-1,3-diol |
| Wikipedia | Resveratrol |
| ChemIDPlus | 000501360 |
| HMDb | HMDB03747 |
| PubChem | 445154 |
| KEGG | C03582 |
| ChemSpider | 392875 |
| ChEMBL | CHEMBL165 |
| ChEBI | CHEBI:45713 |