Systematic / IUPAC Name: 1-(4-Chlorophenyl)-2-(1-pyrrolidinyl)-1-propanone
ID: Reference5742
Other Names: 1-Propanone, 1-(4-chlorophenyl)-2-(1-pyrrolidinyl)-
Formula: C13H16ClNO
Class: Drugs of Abuse/Illegal Drugs
4'-Chloro-α-pyrrolidinopropiophenone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/3/2016 1:30:44 PM |
| InChI | InChI=1S/C13H16ClNO/c1-10(15-8-2-3-9-15)13(16)11-4-6-12(14)7-5-11/h4-7,10H,2-3,8-9H2,1H3 |
| InChI Key | ULRSISQFKHWZNP-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(=O)C1=CC=C(C=C1)Cl)N2CCCC2 |
| CAS | |
| Splash | |
| Other Names | 1-Propanone, 1-(4-chlorophenyl)-2-(1-pyrrolidinyl)- |