Systematic / IUPAC Name: 1-(2-methoxyphenyl)-2-(methylamino)propan-1-one
ID: Reference5752
Other Names: 2-MeOMC
Formula: C11H15NO2
Class: Drugs of Abuse/Illegal Drugs
2-Methoxymethcathinone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/4/2016 12:35:00 PM |
| InChI | InChI=1S/C11H15NO2/c1-8(12-2)11(13)9-6-4-5-7-10(9)14-3/h4-8,12H,1-3H3 |
| InChI Key | JKVDLNRJQFVERN-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(=O)C1=CC=CC=C1OC)NC |
| CAS | |
| Splash | |
| Other Names | 2-MeOMC |
| PubChem | 82101005 |