Systematic / IUPAC Name: 1-Phenyl-2-(1-pyrrolidinyl)-1-heptanone
ID: Reference5753
Other Names:
1-Phenyl-2-(pyrrolidin-1-yl)heptan-1-one;
1-Heptanone, 1-phenyl-2-(1-pyrrolidinyl)-
Formula: C17H25NO
Class: Drugs of Abuse/Illegal Drugs
PV8 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/4/2016 10:58:16 AM |
| InChI | InChI=1S/C17H25NO/c1-2-3-5-12-16(18-13-8-9-14-18)17(19)15-10-6-4-7-11-15/h4,6-7,10-11,16H,2-3,5,8-9,12-14H2,1H3 |
| InChI Key | DLRWKNLMJAIFQB-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCC(C(=O)C1=CC=CC=C1)N2CCCC2 |
| CAS | |
| Splash | |
| Other Names |
1-Phenyl-2-(pyrrolidin-1-yl)heptan-1-one; 1-Heptanone, 1-phenyl-2-(1-pyrrolidinyl)- |