Systematic / IUPAC Name: [1-(2-Heptanyl)-2-methyl-1H-indol-3-yl](1-naphthyl)methanone
ID: Reference5768
Other Names:
[2-Methyl-1-(1-methylhexyl)-1H-indol-3-yl]-1-naphthalenyl-methanone;
Methanone, [2-methyl-1-(1-methylhexyl)-1H-indol-3-yl]-1-naphthalenyl-;
JWH 004 1-methylhexyl analog
Formula: C27H29NO
Class: Drugs of Abuse/Illegal Drugs
JWH 011 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/6/2016 6:32:10 AM |
| InChI | InChI=1S/C27H29NO/c1-4-5-6-12-19(2)28-20(3)26(24-16-9-10-18-25(24)28)27(29)23-17-11-14-21-13-7-8-15-22(21)23/h7-11,13-19H,4-6,12H2,1-3H3 |
| InChI Key | HVIWIQFCDXFBDK-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCC(C)N1C(=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43)C |
| CAS | 155471139 |
| Splash | |
| Other Names |
[2-Methyl-1-(1-methylhexyl)-1H-indol-3-yl]-1-naphthalenyl-methanone; Methanone, [2-methyl-1-(1-methylhexyl)-1H-indol-3-yl]-1-naphthalenyl-; JWH 004 1-methylhexyl analog |
| ChEMBL | CHEMBL152187 |
| ChemSpider | 23224565 |
| PubChem | 44368442 |