Systematic / IUPAC Name: N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide
ID: Reference5809
Other Names:
Formula: C24H21FN4O2
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
APP-FUBINACA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 2267 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/14/2018 11:37:09 AM |
| InChI | InChI=1S/C24H21FN4O2/c25-18-12-10-17(11-13-18)15-29-21-9-5-4-8-19(21)22(28-29)24(31)27-20(23(26)30)14-16-6-2-1-3-7-16/h1-13,20H,14-15H2,(H2,26,30)(H,27,31)/t20-/m0/s1 |
| InChI Key | TZXBEYFALIFOAG-FQEVSTJZSA-N |
| Canonical SMILES | C1=CC=C(C=C1)CC(C(=O)N)NC(=O)C2=NN(C3=CC=CC=C32)CC4=CC=C(C=C4)F |
| CAS | 1185282034 |
| Splash | |
| Other Names |
| PubChem | 58124515 |
| Wikipedia | APP-FUBINACA |