Systematic / IUPAC Name: Methyl 2-{[1-(cyclohexylmethyl)indole-3-carbonyl]amino}-3-methylbutanoate
ID: Reference5813
Other Names: Methyl N-[1-(cyclohexylmethyl)-1H-indole-3-carbonyl)valinate
Formula: C22H30N2O3
Class: Drugs of Abuse/Illegal Drugs
MMB-CHMICA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/24/2016 10:51:55 AM |
| InChI | InChI=1S/C22H30N2O3/c1-15(2)20(22(26)27-3)23-21(25)18-14-24(13-16-9-5-4-6-10-16)19-12-8-7-11-17(18)19/h7-8,11-12,14-16,20H,4-6,9-10,13H2,1-3H3,(H,23,25) |
| InChI Key | ROWZIXRLVUOMCJ-FQEVSTJZSA-N |
| Canonical SMILES | CC(C)C(C(=O)OC)NC(=O)C1=CN(C2=CC=CC=C21)CC3CCCCC3 |
| CAS | |
| Splash | |
| Other Names | Methyl N-[1-(cyclohexylmethyl)-1H-indole-3-carbonyl)valinate |
| PubChem | 121494125 |