Systematic / IUPAC Name: 8-Methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylic acid
ID: Reference582
Other Names:
(1R)-8-Methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylic acid;
8-Azabicyclo[3.2.1]oct-2-ene-2-carboxylic acid, 8-methyl-, (1R)-;
Ecognidine
Formula: C9H13NO2
Class: Drugs of Abuse/Illegal Drugs
Anhydroecgonine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 112 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/9/2015 2:39:26 PM |
| InChI | InChI=1S/C9H13NO2/c1-10-6-2-4-7(9(11)12)8(10)5-3-6/h4,6,8H,2-3,5H2,1H3,(H,11,12) |
| InChI Key | HZGRVVUQEIBCMS-UHFFFAOYSA-N |
| Canonical SMILES | CN1C2CCC1C(=CC2)C(=O)O |
| CAS | 484935 |
| Splash | |
| Other Names |
(1R)-8-Methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylic acid; 8-Azabicyclo[3.2.1]oct-2-ene-2-carboxylic acid, 8-methyl-, (1R)-; Ecognidine |
| ChemIDPlus | 000484935 |
| Wikipedia | Ecgonidine |
| ChemSpider | 91897 |
| PubChem | 101709 |