Systematic / IUPAC Name: N-[(3s,5s,7s)-adamantan-1-yl]-1-(5-chloropentyl)-1H-indazole-3-carboxamide
ID: Reference5899
Other Names: 5-Chloro APINACA
Formula: C23H30ClN3O
Class: Drugs of Abuse/Illegal Drugs
5-Chloro AKB48 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/4/2016 11:01:40 AM |
| InChI | 1S/C23H30ClN3O/c24-8-4-1-5-9-27-20-7-3-2-6-19(20)21(26-27)22(28)25-23-13-16-10-17(14-23)12-18(11-16)15-23/h2-3,6-7,16-18H,1,4-5,8-15H2,(H,25,28)/t16-,17+,18-,23? |
| InChI Key | LGENBCKWDLSPTD-XHICYHHKSA-N |
| Canonical SMILES | ClCCCCCN1N=C(C(NC23C[C@H]4C[C@H](C[C@@H](C3)C4)C2)=O)C5=CC=CC=C51 |
| CAS | |
| Splash | |
| Other Names | 5-Chloro APINACA |