Systematic / IUPAC Name: [1-(5-Fluoropentyl)-1H-indol-3-yl)(pyrrolidin-1-yl]methanone
ID: Reference5901
Other Names:
Formula: C18H23FN2O
Class: Drugs of Abuse/Illegal Drugs
5-Fluoro PY-PICA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/4/2016 12:42:09 PM |
| InChI | 1S/C18H23FN2O/c19-10-4-1-5-13-21-14-16(15-8-2-3-9-17(15)21)18(22)20-11-6-7-12-20/h2-3,8-9,14H,1,4-7,10-13H2 |
| InChI Key | AJOAHRJLOXOZKX-UHFFFAOYSA-N |
| Canonical SMILES | O=C(N1CCCC1)C2=CN(CCCCCF)C3=C2C=CC=C3 |
| CAS | |
| Splash | |
| Other Names |