Systematic / IUPAC Name: 1-[1-(2-Thienyl)cyclohexyl]piperidine
ID: Reference5943
Other Names:
[(Thienyl-2)-1 cyclohexyl]-N- piperidine ;
1-(1-Thiophen-2-ylcyclohexyl)piperidine;
1-[1-(2-Thienyl)cyclohexyl]piperidine ;
1-[1-(Thiophen-2-yl)cyclohexyl]piperidine;
Piperidine, 1-[1-(2-thienyl)cyclohexyl]-
; more
Formula: C15H23NS
Class: Drugs of Abuse/Illegal Drugs
Tenocyclidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/9/2016 1:12:34 PM |
| InChI | InChI=1S/C15H23NS/c1-3-9-15(10-4-1,14-8-7-13-17-14)16-11-5-2-6-12-16/h7-8,13H,1-6,9-12H2 |
| InChI Key | JUZZEWSCNBCFRL-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)(C2=CC=CS2)N3CCCCC3 |
| CAS | |
| Splash | |
| Other Names |
[(Thienyl-2)-1 cyclohexyl]-N- piperidine ; 1-(1-Thiophen-2-ylcyclohexyl)piperidine; 1-[1-(2-Thienyl)cyclohexyl]piperidine ; 1-[1-(Thiophen-2-yl)cyclohexyl]piperidine; Piperidine, 1-[1-(2-thienyl)cyclohexyl]- ; Thienyl cyclohexylpiperidine; TCP |
| ChEMBL | CHEMBL279676 |
| ChEBI | CHEBI:64610 |
| PubChem | 62751 |
| Wikipedia | Tenocyclidine |
| DrugBank | DB01520 |
| ChemIDPlus | 021500981; 001867658 |
| ChemSpider | 56495 |