Systematic / IUPAC Name: N-(naphthalen-1-yl)-2-pentyl-2H-indazole-3-carboxamide
ID: Reference5957
Other Names: MN-018 2'-indazole isomer
Formula: C23H23N3O
Class: Drugs of Abuse/Illegal Drugs
NNEI 2'-indazole isomer mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 228 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/10/2016 11:25:42 AM |
| InChI | 1S/C23H23N3O/c1-2-3-8-16-26-22(19-13-6-7-14-21(19)25-26)23(27)24-20-15-9-11-17-10-4-5-12-18(17)20/h4-7,9-15H,2-3,8,16H2,1H3,(H,24,27) |
| InChI Key | CCKAFWQEZXFESA-UHFFFAOYSA-N |
| Canonical SMILES | O=C(NC1=C2C(C=CC=C2)=CC=C1)C3=C4C(C=CC=C4)=NN3CCCCC |
| CAS | |
| Splash | |
| Other Names | MN-018 2'-indazole isomer |