Systematic / IUPAC Name: 2-(1-{2-Oxo-2-[2-(4-sulfamoylphenyl)hydrazinyl]ethyl}cyclopentyl)acetic acid
ID: Reference5984
Other Names:
Formula: C15H21N3O5S
2-[1-(2-{2-[4-(Aminosulfonyl)phenyl]hydrazino}-2-oxoethyl)cyclopentyl]acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/15/2016 9:47:56 AM |
| InChI | InChI=1S/C15H21N3O5S/c16-24(22,23)12-5-3-11(4-6-12)17-18-13(19)9-15(10-14(20)21)7-1-2-8-15/h3-6,17H,1-2,7-10H2,(H,18,19)(H,20,21)(H2,16,22,23) |
| InChI Key | XEJBUPXPDPAYHY-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(C1)(CC(=O)NNC2=CC=C(C=C2)S(=O)(=O)N)CC(=O)O |
| CAS | |
| Splash | |
| Other Names |