Systematic / IUPAC Name: N'-(3-Chlorophenyl)cyclohexanecarbohydrazide
ID: Reference5987
Other Names: Cyclohexanecarboxylic acid, 2-(3-chlorophenyl)hydrazide
Formula: C13H17ClN2O
N'-(3-Chlorophenyl)cyclohexanecarbohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/15/2016 9:57:50 AM |
| InChI | InChI=1S/C13H17ClN2O/c14-11-7-4-8-12(9-11)15-16-13(17)10-5-2-1-3-6-10/h4,7-10,15H,1-3,5-6H2,(H,16,17) |
| InChI Key | JJXLOUUHJTWKLK-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)C(=O)NNC2=CC(=CC=C2)Cl |
| CAS | |
| Splash | |
| Other Names | Cyclohexanecarboxylic acid, 2-(3-chlorophenyl)hydrazide |