Systematic / IUPAC Name: [5-(2-Methyl-2-propanyl)-2-thienyl](1-pyrrolidinyl)methanone
ID: Reference6022
Other Names: Methanone, [5-(1,1-dimethylethyl)-2-thienyl]-1-pyrrolidinyl-
Formula: C13H19NOS
[5-(tert-Butyl)-2-thienyl](1-pyrrolidinyl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/18/2016 6:55:55 AM |
| InChI | InChI=1S/C13H19NOS/c1-13(2,3)11-7-6-10(16-11)12(15)14-8-4-5-9-14/h6-7H,4-5,8-9H2,1-3H3 |
| InChI Key | NMXUYRLEYFWAEC-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)C1=CC=C(S1)C(=O)N2CCCC2 |
| CAS | |
| Splash | |
| Other Names | Methanone, [5-(1,1-dimethylethyl)-2-thienyl]-1-pyrrolidinyl- |
| ChemSpider | 2023094 |
| PubChem | 2741532 |
| ChEMBL | CHEMBL1573062 |