Systematic / IUPAC Name: (4Z)-2,5-Dimethyl-4-{[5-(methylsulfanyl)-2-thienyl]methylene}-2,4-dihydro-3H-pyrazol-3-one
ID: Reference6027
Other Names:
Formula: C11H12N2OS2
1,3-Dimethyl-4-{[5-(methylthio)-2-thienyl]methylidene}-4,5-dihydro-1H-pyrazol-5-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/18/2016 8:42:04 AM |
| InChI | InChI=1S/C11H12N2OS2/c1-7-9(11(14)13(2)12-7)6-8-4-5-10(15-3)16-8/h4-6H,1-3H3/b9-6- |
| InChI Key | ULISMHXMJFEXBU-TWGQIWQCSA-N |
| Canonical SMILES | CC1=NN(C(=O)C1=CC2=CC=C(S2)SC)C |
| CAS | |
| Splash | |
| Other Names |