Systematic / IUPAC Name: (2,4-Dihydroxyphenyl)(phenyl)methanone
ID: Reference604
Other Names:
Methanone, (2,4-dihydroxyphenyl)phenyl-;
Benzophenone, 2,4-dihydroxy-;
4-Benzoylresorcinol;
2,4-Dihydroxy benzophenone;
2,4-Dihydroxyphenyl phenyl ketone
; more
Formula: C13H10O3
Class: Industrial Chemicals
2,4-Dihydroxybenzophenone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/21/2014 2:56:29 PM |
| InChI | InChI=1S/C13H10O3/c14-10-6-7-11(12(15)8-10)13(16)9-4-2-1-3-5-9/h1-8,14-15H |
| InChI Key | ZXDDPOHVAMWLBH-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=C(C=C2)O)O |
| CAS | 131566 |
| Splash | |
| Other Names |
Methanone, (2,4-dihydroxyphenyl)phenyl-; Benzophenone, 2,4-dihydroxy-; 4-Benzoylresorcinol; 2,4-Dihydroxy benzophenone; 2,4-Dihydroxyphenyl phenyl ketone; 2,4-Dihydroxybenzofenon; Benzoresorcinol; Resbenzophenone; Uvinol 400; Uvinul 400; Aduvex 12; Quinsorb 010; Syntase 100 |
| PubChem | 8572 |
| ChemIDPlus | 000131566 |
| ChemSpider | 8254 |
| ChEMBL | CHEMBL1392 |
| Wikipedia | 2,4-Dihydroxybenzophenon (DE) |
| KEGG | C14215 |