Systematic / IUPAC Name: 2-(2,5-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]ethanamine
ID: Reference6062
Other Names: 25H-NBOMe 4-methoxy isomer
Formula: C18H23NO3
Class: Drugs of Abuse/Illegal Drugs
25H-NB4OMe mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/22/2016 8:38:26 AM |
| InChI | InChI=1S/C18H23NO3/c1-20-16-6-4-14(5-7-16)13-19-11-10-15-12-17(21-2)8-9-18(15)22-3/h4-9,12,19H,10-11,13H2,1-3H3 |
| InChI Key | RIQSJIKRFRLJRV-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)CNCCC2=C(C=CC(=C2)OC)OC |
| CAS | |
| Splash | |
| Other Names | 25H-NBOMe 4-methoxy isomer |
| PubChem | 39424375 |