Systematic / IUPAC Name: 1-(2,6-Dichlorophenyl)-1,3-dihydro-2H-imidazole-2-thione
ID: Reference6081
Other Names: 2H-Imidazole-2-thione, 1-(2,6-dichlorophenyl)-1,3-dihydro-
Formula: C9H6Cl2N2S
1-(2,6-Dichlorophenyl)-2,3-dihydro-1H-imidazole-2-thione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/24/2016 12:27:00 PM |
| InChI | InChI=1S/C9H6Cl2N2S/c10-6-2-1-3-7(11)8(6)13-5-4-12-9(13)14/h1-5H,(H,12,14) |
| InChI Key | MBLFDPTVVARISG-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)Cl)N2C=CNC2=S)Cl |
| CAS | |
| Splash | |
| Other Names | 2H-Imidazole-2-thione, 1-(2,6-dichlorophenyl)-1,3-dihydro- |
| ChEMBL | CHEMBL1488356 |
| PubChem | 2728546 |
| ChemSpider | 2010539 |