Systematic / IUPAC Name: N'-(4-Chlorobenzoyl)-4-methoxythiophene-3-carbohydrazide
ID: Reference6117
Other Names:
3-Thiophenecarboxylic acid, 4-methoxy-, 2-(4-chlorobenzoyl)hydrazide;
N'3-(4-Chlorobenzoyl)-4-methoxythiophene-3-carbohydrazide
Formula: C13H11ClN2O3S
N'3-(4-Chlorobenzoyl)-4-methoxythiophene-3-carbohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/28/2016 12:15:44 PM |
| InChI | InChI=1S/C13H11ClN2O3S/c1-19-11-7-20-6-10(11)13(18)16-15-12(17)8-2-4-9(14)5-3-8/h2-7H,1H3,(H,15,17)(H,16,18) |
| InChI Key | OGPDEXFLDWQLNX-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CSC=C1C(=O)NNC(=O)C2=CC=C(C=C2)Cl |
| CAS | |
| Splash | |
| Other Names |
3-Thiophenecarboxylic acid, 4-methoxy-, 2-(4-chlorobenzoyl)hydrazide; N'3-(4-Chlorobenzoyl)-4-methoxythiophene-3-carbohydrazide |