Systematic / IUPAC Name: 2-Hydroxypropyl methacrylate
ID: Reference614
Other Names:
β-Hydroxypropyl methacrylate;
2-Hydroxypropyl 2-methylacrylate;
2-Propenoic acid, 2-methyl-, 2-hydroxypropyl ester;
2-Hydroxypropyl 2-methyl-2-propenoate;
Methacrylic acid, 2-hydroxypropyl ester
; more
Formula: C7H12O3
Class: Industrial Chemicals
2-Hydroxypropyl methacrylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/12/2015 10:07:49 AM |
| InChI | InChI=1S/C7H12O3/c1-5(2)7(9)10-4-6(3)8/h6,8H,1,4H2,2-3H3 |
| InChI Key | VHSHLMUCYSAUQU-UHFFFAOYSA-N |
| Canonical SMILES | CC(COC(=O)C(=C)C)O |
| CAS | 25703791 |
| Splash | |
| Other Names |
β-Hydroxypropyl methacrylate; 2-Hydroxypropyl 2-methylacrylate; 2-Propenoic acid, 2-methyl-, 2-hydroxypropyl ester; 2-Hydroxypropyl 2-methyl-2-propenoate; Methacrylic acid, 2-hydroxypropyl ester; 2-Hydroxy-n-propyl methacrylate; 2-Hydroxy-3-propyl methacrylate; Methacrylic acid 2-hydroxypropyl ester |
| ChEMBL | CHEMBL1873783 |
| PubChem | 13539 |
| ChEBI | CHEBI:53440 |
| ChemIDPlus | 000923262; 025703791 |
| ChemSpider | 12951 |