Systematic / IUPAC Name: 1-S-[(1E)-5-(Methylsulfinyl)-N-(sulfooxy)pentanimidoyl]-1-thio-β-D-glucopyranose
ID: Reference6146
Other Names:
Sulforaphane glucosinolate;
1-Thio-1-[5-(methylsulfinyl)-N-(sulfooxy)pentanimidate]-β-D-glucopyranose ;
4-Methylsulfinylbutyl glucosinolate
Formula: C12H23NO10S3
Class: Endogenous Metabolites Natural Products/Medicines
Glucoraphanin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 300 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 12/12/2016 8:31:58 AM |
| InChI | InChI=1S/C12H23NO10S3/c1-25(18)5-3-2-4-8(13-23-26(19,20)21)24-12-11(17)10(16)9(15)7(6-14)22-12/h7,9-12,14-17H,2-6H2,1H3,(H,19,20,21)/b13-8+/t7-,9-,10+,11-,12+,25?/m1/s1 |
| InChI Key | GMMLNKINDDUDCF-RFOBZYEESA-N |
| Canonical SMILES | CS(=O)CCCCC(=NOS(=O)(=O)O)SC1C(C(C(C(O1)CO)O)O)O |
| CAS | 21414415 |
| Splash | |
| Other Names |
Sulforaphane glucosinolate; 1-Thio-1-[5-(methylsulfinyl)-N-(sulfooxy)pentanimidate]-β-D-glucopyranose ; 4-Methylsulfinylbutyl glucosinolate |
| ChemSpider | 7827557 |
| PubChem | 9548634 |
| Wikipedia | Glucoraphanin |