Systematic / IUPAC Name: (2Z)-3-Methoxy-5-methyl-4-oxohexa-2,5-dienoic acid
ID: Reference6175
Other Names:
(2Z)-3-Methoxy-5-methyl-4-oxo-2,5-hexadienoic acid;
2,5-Hexadienoic acid, 3-methoxy-5-methyl-4-oxo-, (2Z)-
Formula: C8H10O4
Class: Natural Toxins
Penicillic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1846 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 12/15/2016 12:02:12 PM |
| InChI | InChI=1S/C8H10O4/c1-5(2)8(11)6(12-3)4-7(9)10/h4H,1H2,2-3H3,(H,9,10)/b6-4- |
| InChI Key | VOUGEZYPVGAPBB-XQRVVYSFSA-N |
| Canonical SMILES | CC(=C)C(=O)C(=CC(=O)O)OC |
| CAS | 90653 |
| Splash | |
| Other Names |
(2Z)-3-Methoxy-5-methyl-4-oxo-2,5-hexadienoic acid; 2,5-Hexadienoic acid, 3-methoxy-5-methyl-4-oxo-, (2Z)- |
| ChemSpider | 1064791 |
| Wikipedia | Penicillic acid |
| ChemIDPlus | 074667520; 000090653 |
| PubChem | 1268111 |