Systematic / IUPAC Name: 1-(4-Chlorophenyl)-2-(1-pyrrolidinyl)-1-pentanone
ID: Reference6251
Other Names:
4-Chloro-α-PVP ;
1-Pentanone, 1-(4-chlorophenyl)-2-(1-pyrrolidinyl)-;
4'-chloro-α-Pyrrolidinovalerophenone
Formula: C15H20ClNO
Class: Drugs of Abuse/Illegal Drugs
4-Chloro-α-pyrrolidinovalerophenone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/26/2017 12:47:23 PM |
| InChI | InChI=1S/C15H20ClNO/c1-2-5-14(17-10-3-4-11-17)15(18)12-6-8-13(16)9-7-12/h6-9,14H,2-5,10-11H2,1H3 |
| InChI Key | NIGBFBTVONRYQN-UHFFFAOYSA-N |
| Canonical SMILES | CCCC(C(=O)C1=CC=C(C=C1)Cl)N2CCCC2 |
| CAS | |
| Splash | |
| Other Names |
4-Chloro-α-PVP ; 1-Pentanone, 1-(4-chlorophenyl)-2-(1-pyrrolidinyl)-; 4'-chloro-α-Pyrrolidinovalerophenone |
| ChemSpider | 52085629 |
| Wikipedia | 4-Chloro-alpha-pyrrolidinovalerophenone |
| PubChem | 69245309 |