Systematic / IUPAC Name: {6-Bromo-2-methyl-1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl}(4-methoxyphenyl)methanone
ID: Reference6293
Other Names:
[6-Bromo-2-methyl-1-(2-morpholin-4-yl-ethyl)-1H-indol-3-yl]-(4-methoxy-phenyl)-methanone;
Methanone, [6-bromo-2-methyl-1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl](4-methoxyphenyl)-;
6-Bromopravadoline
Formula: C23H25BrN2O3
Class: Drugs of Abuse/Illegal Drugs
WIN 54,461 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/17/2017 1:56:15 PM |
| InChI | InChI=1S/C23H25BrN2O3/c1-16-22(23(27)17-3-6-19(28-2)7-4-17)20-8-5-18(24)15-21(20)26(16)10-9-25-11-13-29-14-12-25/h3-8,15H,9-14H2,1-2H3 |
| InChI Key | DUYGSAPQVOBOCS-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C2=C(N1CCN3CCOCC3)C=C(C=C2)Br)C(=O)C4=CC=C(C=C4)OC |
| CAS | 166599639 |
| Splash | |
| Other Names |
[6-Bromo-2-methyl-1-(2-morpholin-4-yl-ethyl)-1H-indol-3-yl]-(4-methoxy-phenyl)-methanone; Methanone, [6-bromo-2-methyl-1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl](4-methoxyphenyl)-; 6-Bromopravadoline |
| ChEMBL | CHEMBL310741 |
| Wikipedia | WIN_54,461 |
| PubChem | 9868699 |
| ChemSpider | 8044390 |