Systematic / IUPAC Name: 2-(4-Morpholinyl)ethyl 1-phenylcyclohexanecarboxylate
ID: Reference6297
Other Names:
1-Phenyl-cyclohexanecarboxylic acid 2-morpholin-4-yl-ethyl ester;
2-(4-Morpholino)ethyl-1-phenylcyclohexane-1-carboxylate;
2-(Morpholin-4-yl)ethyl 1-phenylcyclohexanecarboxylate;
2-Morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate;
2-Morpholinoethyl 1-phenylcyclohexanecarboxylate
Formula: C19H27NO3
Class: Drugs of Abuse/Illegal Drugs
PRE-084 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/20/2017 7:56:21 AM |
| InChI | InChI=1S/C19H27NO3/c21-18(23-16-13-20-11-14-22-15-12-20)19(9-5-2-6-10-19)17-7-3-1-4-8-17/h1,3-4,7-8H,2,5-6,9-16H2 |
| InChI Key | RQHKZUBCUZVZEF-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)(C2=CC=CC=C2)C(=O)OCCN3CCOCC3 |
| CAS | |
| Splash | |
| Other Names |
1-Phenyl-cyclohexanecarboxylic acid 2-morpholin-4-yl-ethyl ester; 2-(4-Morpholino)ethyl-1-phenylcyclohexane-1-carboxylate; 2-(Morpholin-4-yl)ethyl 1-phenylcyclohexanecarboxylate; 2-Morpholin-4-ylethyl 1-phenylcyclohexane-1-carboxylate; 2-Morpholinoethyl 1-phenylcyclohexanecarboxylate; Cyclohexanecarboxylic acid, 1-phenyl-, 2-(4-morpholinyl)ethyl ester |
| ChEBI | CHEBI:93007 |
| Wikipedia | PRE-084 |
| ChemIDPlus | 138847855 |
| ChEMBL | CHEMBL305881 |
| ChemSpider | 112335 |
| PubChem | 126402 |