Systematic / IUPAC Name: 9-Phenylthieno[3,2-E][1,2,4]triazolo[4,3-c]pyrimidine
ID: Reference6338
Other Names: Thieno[3,2-E]-1,2,4-triazolo[4,3-c]pyrimidine, 9-phenyl-
Formula: C13H8N4S
9-Phenylthieno[3,2-e][1,2,4]triazolo[4,3-c]pyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/23/2017 2:42:44 PM |
| InChI | InChI=1S/C13H8N4S/c1-2-4-9(5-3-1)10-6-18-13-11(10)12-16-15-8-17(12)7-14-13/h1-8H |
| InChI Key | IHYCWHDELTTWEI-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=CSC3=C2C4=NN=CN4C=N3 |
| CAS | |
| Splash | |
| Other Names | Thieno[3,2-E]-1,2,4-triazolo[4,3-c]pyrimidine, 9-phenyl- |
| PubChem | 360857 |
| ChEMBL | CHEMBL1489737 |
| ChemSpider | 320340 |