Systematic / IUPAC Name: N-{1-[2-(2-Chlorophenyl)sulfonylhydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl}-4-(trifluoromethyl)benzamide
ID: Reference6369
Other Names:
Formula: C19H19ClF3N3O4S2
N-1-[1-({2-[(2-Chlorophenyl)sulfonyl]hydrazino}carbonyl)-3-(methylthio)propyl]-4-(trifluoromethyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2017 9:15:16 AM |
| InChI | InChI=1S/C19H19ClF3N3O4S2/c1-31-11-10-15(24-17(27)12-6-8-13(9-7-12)19(21,22)23)18(28)25-26-32(29,30)16-5-3-2-4-14(16)20/h2-9,15,26H,10-11H2,1H3,(H,24,27)(H,25,28) |
| InChI Key | FDUFUMYTLNUFKP-UHFFFAOYSA-N |
| Canonical SMILES | CSCCC(C(=O)NNS(=O)(=O)C1=CC=CC=C1Cl)NC(=O)C2=CC=C(C=C2)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names |