Systematic / IUPAC Name: N-Phenylacetamide
ID: Reference637
Other Names:
Acetamide, N-phenyl-;
Acetic acid amide, N-phenyl-;
N-Acetylaminobenzene;
Antifebrin;
Acetylaniline
; more
Formula: C8H9NO
Class: Therapeutics/Prescription Drugs
Acetanilide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/16/2015 9:04:50 AM |
| InChI | InChI=1S/C8H9NO/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10) |
| InChI Key | FZERHIULMFGESH-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC1=CC=CC=C1 |
| CAS | 55576551 |
| Splash | |
| Other Names |
Acetamide, N-phenyl-; Acetic acid amide, N-phenyl-; N-Acetylaminobenzene; Antifebrin; Acetylaniline; Acetanil; N-Acetylaniline; Acetoanilide; Phenalgene; Phenalgin; N-Acetylarylamine; Aniline, N-acetyl-; Ethananilide; Benzenamine, N-acetyl- |
| Wikipedia | Acetanilide |
| HMDb | HMDB01250 |
| ChemSpider | 880 |
| PubChem | 904 |
| ChemIDPlus | 000103844 |
| KEGG | C02558; C07565 |
| ChEMBL | CHEMBL269644 |
| ChEBI | CHEBI:28884 |