Systematic / IUPAC Name: 2-(2,4-Dichlorobenzoyl)-4-phenylcyclohexane-1,3-dione
ID: Reference6378
Other Names: 1,3-Cyclohexanedione, 2-(2,4-dichlorobenzoyl)-4-phenyl-
Formula: C19H14Cl2O3
2-(2,4-Dichlorobenzoyl)-4-phenyl-1,3-cyclohexanedione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 120 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2017 12:26:43 PM |
| InChI | InChI=1S/C19H14Cl2O3/c20-12-6-7-14(15(21)10-12)19(24)17-16(22)9-8-13(18(17)23)11-4-2-1-3-5-11/h1-7,10,13,17H,8-9H2 |
| InChI Key | IGEOSXNEZHLFIR-UHFFFAOYSA-N |
| Canonical SMILES | C1CC(=O)C(C(=O)C1C2=CC=CC=C2)C(=O)C3=C(C=C(C=C3)Cl)Cl |
| CAS | |
| Splash | |
| Other Names | 1,3-Cyclohexanedione, 2-(2,4-dichlorobenzoyl)-4-phenyl- |