Systematic / IUPAC Name: N'-[(E)-[3-(4-Methoxyphenyl)pyrazol-4-ylidene]methyl]pyridine-3-carbohydrazide
ID: Reference6383
Other Names: 3-Pyridinecarboxylic acid, 2-{(E)-[3-(4-methoxyphenyl)-4H-pyrazol-4-ylidene]methyl}hydrazide
Formula: C17H15N5O2
N'-{[3-(4-Methoxyphenyl)-1H-pyrazol-4-yl]methylene}nicotinohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/28/2017 6:39:20 AM |
| InChI | InChI=1S/C17H15N5O2/c1-24-15-6-4-12(5-7-15)16-14(10-19-21-16)11-20-22-17(23)13-3-2-8-18-9-13/h2-11,20H,1H3,(H,22,23)/b14-11+ |
| InChI Key | AOGWZQNWDDLDOH-SDNWHVSQSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C2=NN=CC2=CNNC(=O)C3=CN=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 3-Pyridinecarboxylic acid, 2-{(E)-[3-(4-methoxyphenyl)-4H-pyrazol-4-ylidene]methyl}hydrazide |