Systematic / IUPAC Name: 4-Phenyl-1H-imidazole
ID: Reference6386
Other Names:
1H-Imidazole, 4-phenyl-;
4(5)-Phenylimidazole;
4-Phenyl imidazole;
4-Phenylimidazole, 4-π;
Imidazole, 4-phenyl-
Formula: C9H8N2
4-Phenylimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/28/2017 6:52:37 AM |
| InChI | InChI=1S/C9H8N2/c1-2-4-8(5-3-1)9-6-10-7-11-9/h1-7H,(H,10,11) |
| InChI Key | XHLKOHSAWQPOFO-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=CN=CN2 |
| CAS | |
| Splash | |
| Other Names |
1H-Imidazole, 4-phenyl-; 4(5)-Phenylimidazole; 4-Phenyl imidazole; 4-Phenylimidazole, 4-π; Imidazole, 4-phenyl-; PIM |
| ChemIDPlus | 000670951 |
| ChEMBL | CHEMBL14145 |
| ChemSpider | 62794 |
| PubChem | 69590 |