Systematic / IUPAC Name: 2-(3,4-Dimethoxyphenyl)-1-(4-pyrimidin-2-ylpiperazin-1-yl)ethanone
ID: Reference6402
Other Names: Ethanone, 2-(3,4-dimethoxyphenyl)-1-[4-(2-pyrimidinyl)-1-piperazinyl]-
Formula: C18H22N4O3
2-(3,4-Dimethoxyphenyl)-1-[4-(2-pyrimidinyl)piperazino]-1-ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/1/2017 6:45:15 AM |
| InChI | InChI=1S/C18H22N4O3/c1-24-15-5-4-14(12-16(15)25-2)13-17(23)21-8-10-22(11-9-21)18-19-6-3-7-20-18/h3-7,12H,8-11,13H2,1-2H3 |
| InChI Key | OJUXANZSHCEZCJ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C=C(C=C1)CC(=O)N2CCN(CC2)C3=NC=CC=N3)OC |
| CAS | |
| Splash | |
| Other Names | Ethanone, 2-(3,4-dimethoxyphenyl)-1-[4-(2-pyrimidinyl)-1-piperazinyl]- |