Systematic / IUPAC Name: Hexanedioic acid
ID: Reference642
Other Names:
1,4-Butanedicarboxylic acid;
1,6-Hexanedioic acid;
Adipinic acid;
Acifloctin;
Adilactetten
Formula: C6H10O4
Class: Industrial Chemicals Excipients/Additives/Colorants
Adipic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 185 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/12/2016 7:09:26 AM |
| InChI | InChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10) |
| InChI Key | WNLRTRBMVRJNCN-UHFFFAOYSA-N |
| Canonical SMILES | C(CCC(=O)O)CC(=O)O |
| CAS | 124049 |
| Splash | |
| Other Names |
1,4-Butanedicarboxylic acid; 1,6-Hexanedioic acid; Adipinic acid; Acifloctin; Adilactetten |
| ChEMBL | CHEMBL1157 |
| ChemIDPlus | 000142881; 007486386; 007486397; 015511816; 016031837; 019628285; 019628296; 000124049; 031699726; 031699748 |
| LipidsMAPs | LMFA01170048 |
| PubChem | 196 |
| Wikipedia | Adipic acid |
| ChEBI | CHEBI:30832 |
| HMDb | HMDB00448 |
| ChemSpider | 191 |
| KEGG | C06104; D02145; D08839 |