Systematic / IUPAC Name: 4-Cyclohexyl-1-methyl-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione
ID: Reference6438
Other Names: 1H-1,4-Benzodiazepine-2,5-dione, 4-cyclohexyl-3,4-dihydro-1-methyl-
Formula: C16H20N2O2
4-Cyclohexyl-1-methyl-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine-2,5-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2017 6:40:57 AM |
| InChI | InChI=1S/C16H20N2O2/c1-17-14-10-6-5-9-13(14)16(20)18(11-15(17)19)12-7-3-2-4-8-12/h5-6,9-10,12H,2-4,7-8,11H2,1H3 |
| InChI Key | OGWXMLBQWRVGHL-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=O)CN(C(=O)C2=CC=CC=C21)C3CCCCC3 |
| CAS | |
| Splash | |
| Other Names | 1H-1,4-Benzodiazepine-2,5-dione, 4-cyclohexyl-3,4-dihydro-1-methyl- |
| PubChem | 2806584 |
| ChemSpider | 2085081 |
| ChEMBL | CHEMBL396240 |