Systematic / IUPAC Name: (2-Chlorophenyl)-[2-(4-methoxyphenyl)imino-4-methyl-1,3-thiazol-3-yl]methanone
ID: Reference6449
Other Names: Methanone, (2-chlorophenyl){2-[(4-methoxyphenyl)imino]-4-methyl-3(2H)-thiazolyl}-
Formula: C18H15ClN2O2S
(2-Chlorophenyl){2-[(4-methoxyphenyl)imino]-4-methyl-2,3-dihydro-1,3-thiazol-3-yl}methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/9/2017 9:42:37 AM |
| InChI | InChI=1S/C18H15ClN2O2S/c1-12-11-24-18(20-13-7-9-14(23-2)10-8-13)21(12)17(22)15-5-3-4-6-16(15)19/h3-11H,1-2H3 |
| InChI Key | YIAYNJCXTKUPOL-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CSC(=NC2=CC=C(C=C2)OC)N1C(=O)C3=CC=CC=C3Cl |
| CAS | |
| Splash | |
| Other Names | Methanone, (2-chlorophenyl){2-[(4-methoxyphenyl)imino]-4-methyl-3(2H)-thiazolyl}- |