Systematic / IUPAC Name: 2-[2-(2,6-Dimethyl-4-morpholinyl)-2-oxoethoxy]phenyl dimethylcarbamate
ID: Reference6456
Other Names: Carbamic acid, N,N-dimethyl, 2-[2-(2,6-dimethyl-4-morpholinyl)-2-oxoethoxy]phenyl ester
Formula: C17H24N2O5
2-[2-(2,6-Dimethylmorpholino)-2-oxoethoxy]phenyl N,N-dimethylcarbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2017 7:43:27 AM |
| InChI | InChI=1S/C17H24N2O5/c1-12-9-19(10-13(2)23-12)16(20)11-22-14-7-5-6-8-15(14)24-17(21)18(3)4/h5-8,12-13H,9-11H2,1-4H3 |
| InChI Key | JLTPUKHHZYVRIM-UHFFFAOYSA-N |
| Canonical SMILES | CC1CN(CC(O1)C)C(=O)COC2=CC=CC=C2OC(=O)N(C)C |
| CAS | |
| Splash | |
| Other Names | Carbamic acid, N,N-dimethyl, 2-[2-(2,6-dimethyl-4-morpholinyl)-2-oxoethoxy]phenyl ester |